N-(3-ethoxypropyl)-2-[[2-(3-ethoxypropylcarbamoyl)phenyl]disulfanyl]benzamide structure
|
Common Name | N-(3-ethoxypropyl)-2-[[2-(3-ethoxypropylcarbamoyl)phenyl]disulfanyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 78010-27-2 | Molecular Weight | 476.65200 | |
| Density | 1.21g/cm3 | Boiling Point | 651.2ºC at 760 mmHg | |
| Molecular Formula | C24H32N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.6ºC | |
| Name | N-(3-ethoxypropyl)-2-[[2-(3-ethoxypropylcarbamoyl)phenyl]disulfanyl]benzamide |
|---|
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 651.2ºC at 760 mmHg |
| Molecular Formula | C24H32N2O4S2 |
| Molecular Weight | 476.65200 |
| Flash Point | 347.6ºC |
| Exact Mass | 476.18000 |
| PSA | 134.24000 |
| LogP | 5.94840 |
| Index of Refraction | 1.596 |
| InChIKey | OZTSOQTUKOMLCS-UHFFFAOYSA-N |
| SMILES | CCOCCCNC(=O)c1ccccc1SSc1ccccc1C(=O)NCCCOCC |
|
~72%
N-(3-ethoxyprop... CAS#:78010-27-2 |
| Literature: Yamada; Niino; Hashimoto; Shuto; Nakamizo; Kubo; Ono; Murayama Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1214 - 1220 |
|
~%
N-(3-ethoxyprop... CAS#:78010-27-2 |
| Literature: Yamada; Niino; Hashimoto; Shuto; Nakamizo; Kubo; Ono; Murayama Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 3 p. 1214 - 1220 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |