2-(Trifluoromethyl)-1H-imidazole-4,5-dicarboxylic acid structure
|
Common Name | 2-(Trifluoromethyl)-1H-imidazole-4,5-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 78016-96-3 | Molecular Weight | 224.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3F3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(Trifluoromethyl)-1H-imidazole-4,5-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H3F3N2O4 |
|---|---|
| Molecular Weight | 224.09400 |
| Exact Mass | 224.00400 |
| PSA | 103.28000 |
| LogP | 0.82490 |
| InChIKey | SEIZYICTEVXCSY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nc(C(F)(F)F)[nH]c1C(=O)O |
| HS Code | 2933290090 |
|---|
|
~84%
2-(Trifluoromet... CAS#:78016-96-3 |
| Literature: Owen, D.; Plevey, R. G.; Tatlow, J. C. Journal of Fluorine Chemistry, 1981 , vol. 17, p. 179 - 186 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-trifluoromethylimidazole-4,5-dicarboxylic acid |