methyl 11-methyl-10,13-dioxooctadecanoate structure
|
Common Name | methyl 11-methyl-10,13-dioxooctadecanoate | ||
|---|---|---|---|---|
| CAS Number | 78030-05-4 | Molecular Weight | 340.49700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H36O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 11-methyl-10,13-dioxooctadecanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H36O4 |
|---|---|
| Molecular Weight | 340.49700 |
| Exact Mass | 340.26100 |
| PSA | 60.44000 |
| LogP | 5.02490 |
| InChIKey | OLSQKKDLBMKXHI-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)CC(C)C(=O)CCCCCCCCC(=O)OC |
|
~%
methyl 11-methy... CAS#:78030-05-4 |
| Literature: Jie, Marcel S. F. Lie Ken; Ahmad, Fasih Journal of the Chemical Society, Chemical Communications, 1981 , # 21 p. 1110 - 1111 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Octadecanoic acid,11-methyl-10,13-dioxo-,methyl ester |
| methyl 10,13-dioxo-11-methyloctadecanoate |