8-(hydroxymethyl)-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione structure
|
Common Name | 8-(hydroxymethyl)-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 78033-09-7 | Molecular Weight | 252.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-(hydroxymethyl)-1-methyl-3-(2-methylpropyl)-7H-purine-2,6-dione |
|---|
| Molecular Formula | C11H16N4O3 |
|---|---|
| Molecular Weight | 252.27 |
| InChIKey | GCIAKCHPTBSQKC-UHFFFAOYSA-N |
| SMILES | CC(C)Cn1c(=O)n(C)c(=O)c2[nH]c(CO)nc21 |
|
Name: Inhibition of Peak I phosphodiesterase from pig coronary arteries
Source: ChEMBL
Target: N/A
External Id: CHEMBL882288
|
|
Name: Inhibition of pig coronary artery cAMP-specific phosphodiesterase
Source: ChEMBL
Target: N/A
External Id: CHEMBL758446
|