1-(4-chlorophenyl)-2-methyl-4-(3-nitropyridin-4-yl)piperazine structure
|
Common Name | 1-(4-chlorophenyl)-2-methyl-4-(3-nitropyridin-4-yl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 78069-99-5 | Molecular Weight | 332.78500 | |
| Density | 1.31g/cm3 | Boiling Point | 511.7ºC at 760 mmHg | |
| Molecular Formula | C16H17ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.3ºC | |
| Name | 1-(4-chlorophenyl)-2-methyl-4-(3-nitropyridin-4-yl)piperazine |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 511.7ºC at 760 mmHg |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.78500 |
| Flash Point | 263.3ºC |
| Exact Mass | 332.10400 |
| PSA | 65.19000 |
| LogP | 4.01150 |
| Index of Refraction | 1.615 |
| InChIKey | JNWGJRQWMZFPIO-UHFFFAOYSA-N |
| SMILES | CC1CN(c2ccncc2[N+](=O)[O-])CCN1c1ccc(Cl)cc1 |
|
~%
1-(4-chlorophen... CAS#:78069-99-5 |
| Literature: Saxena, Anil K.; Arunamurthy, V.; Patnaik, G. K.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 10 p. 873 - 878 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |