1-(2,4-dinitrophenyl)-4-[3-(trifluoromethyl)phenyl]piperazine structure
|
Common Name | 1-(2,4-dinitrophenyl)-4-[3-(trifluoromethyl)phenyl]piperazine | ||
|---|---|---|---|---|
| CAS Number | 78070-19-6 | Molecular Weight | 396.32100 | |
| Density | 1.445g/cm3 | Boiling Point | 537.7ºC at 760 mmHg | |
| Molecular Formula | C17H15F3N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279ºC | |
| Name | 1-(2,4-dinitrophenyl)-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.445g/cm3 |
|---|---|
| Boiling Point | 537.7ºC at 760 mmHg |
| Molecular Formula | C17H15F3N4O4 |
| Molecular Weight | 396.32100 |
| Flash Point | 279ºC |
| Exact Mass | 396.10500 |
| PSA | 98.12000 |
| LogP | 5.02480 |
| Index of Refraction | 1.59 |
| InChIKey | LXVGWGHRZBJQMX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(c3cccc(C(F)(F)F)c3)CC2)c([N+](=O)[O-])c1 |
|
~%
1-(2,4-dinitrop... CAS#:78070-19-6 |
| Literature: Saxena, Anil K.; Arunamurthy, V.; Patnaik, G. K.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 10 p. 873 - 878 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(2',4'-dinitrophenyl)-4-(3"-trifluoromethylphenyl)piperazine |