diethyl 2,2-dimethylpentanedioate structure
|
Common Name | diethyl 2,2-dimethylpentanedioate | ||
|---|---|---|---|---|
| CAS Number | 78092-07-6 | Molecular Weight | 216.27400 | |
| Density | 0.996g/cm3 | Boiling Point | 233.2ºC at 760 mmHg | |
| Molecular Formula | C11H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.3ºC | |
| Name | diethyl 2,2-dimethylpentanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.996g/cm3 |
|---|---|
| Boiling Point | 233.2ºC at 760 mmHg |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.27400 |
| Flash Point | 100.3ºC |
| Exact Mass | 216.13600 |
| PSA | 52.60000 |
| LogP | 1.91900 |
| Index of Refraction | 1.433 |
| InChIKey | QIZQGVMVRZIBBS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(C)(C)C(=O)OCC |
| HS Code | 2917190090 |
|---|
|
~%
diethyl 2,2-dim... CAS#:78092-07-6 |
| Literature: Blaise Bulletin de la Societe Chimique de France, 1899 , vol. <3> 21, p. 628 |
|
~%
diethyl 2,2-dim... CAS#:78092-07-6 |
| Literature: Bailey,A.S. et al. Canadian Journal of Chemistry, 1961 , vol. 39, p. 1147 - 1152 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,2-Dimethyl-glutarsaeure-diaethylester |
| Pentanedioic acid,2,2-dimethyl-,diethyl ester |
| 2,2-dimethyl-pentanedioic acid diethyl ester |
| Diethyl 2,2-dimethylglutarate |
| 2,2-Dimethyl-glutarsaeure-diethylester |
| EINECS 278-829-4 |
| 2,2-dimethyl-glutaric acid diethyl ester |