4h-1,3-Benzoxazin-4-one,2-(diethylamino)
Modify Date: 2026-08-03 12:44:49
4h-1,3-Benzoxazin-4-one,2-(diethylamino) structure
|
Common Name | 4h-1,3-Benzoxazin-4-one,2-(diethylamino) | ||
|---|---|---|---|---|
| CAS Number | 781-75-9 | Molecular Weight | 218.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4h-1,3-Benzoxazin-4-one,2-(diethylamino) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14N2O2 |
|---|---|
| Molecular Weight | 218.25 |
| InChIKey | RWIYCXYMCDSHCD-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1nc(=O)c2ccccc2o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 781-75-9? |
| A: Chinese name of 781-75-9 is 781-75-9. |
| Q: What is the InChIKey of 4h-1,3-Benzoxazin-4-one,2-(diethylamino)? |
| A: InChIKey of 4h-1,3-Benzoxazin-4-one,2-(diethylamino) is RWIYCXYMCDSHCD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4h-1,3-Benzoxazin-4-one,2-(diethylamino)? |
| A: Molecular weight of 4h-1,3-Benzoxazin-4-one,2-(diethylamino) is 218.25. |
| Q: What is the molecular formula of 4h-1,3-Benzoxazin-4-one,2-(diethylamino)? |
| A: Molecular formula of 4h-1,3-Benzoxazin-4-one,2-(diethylamino) is C12H14N2O2. |
| Q: What is the CAS number of 4h-1,3-Benzoxazin-4-one,2-(diethylamino)? |
| A: CAS number of 4h-1,3-Benzoxazin-4-one,2-(diethylamino) is 781-75-9. |
| Q: What is the SMILES notation of 4h-1,3-Benzoxazin-4-one,2-(diethylamino)? |
| A: SMILES notation of 4h-1,3-Benzoxazin-4-one,2-(diethylamino) is CCN(CC)c1nc(=O)c2ccccc2o1. |
| Q: What is the English name of 4h-1,3-Benzoxazin-4-one,2-(diethylamino)? |
| A: The English name of 4h-1,3-Benzoxazin-4-one,2-(diethylamino) is 4h-1,3-Benzoxazin-4-one,2-(diethylamino). |