Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate)
Modify Date: 2026-09-18 15:50:51
Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate) structure
|
Common Name | Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate) | ||
|---|---|---|---|---|
| CAS Number | 78103-18-1 | Molecular Weight | 384.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H24O6 |
|---|---|
| Molecular Weight | 384.4 |
| InChIKey | UKFSGKLSXCFJNM-ABZYKWASSA-N |
| SMILES | COC1CC(OC(=O)c2ccc(C)cc2)C(OC(=O)c2ccc(C)cc2)CO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate)? |
| A: InChIKey of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate) is UKFSGKLSXCFJNM-ABZYKWASSA-N. |
| Q: What is the English name of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate)? |
| A: The English name of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate) is Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate). |
| Q: What is the SMILES notation of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate)? |
| A: SMILES notation of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate) is COC1CC(OC(=O)c2ccc(C)cc2)C(OC(=O)c2ccc(C)cc2)CO1. |
| Q: What is the molecular weight of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate)? |
| A: Molecular weight of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate) is 384.4. |
| Q: What is the molecular formula of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate)? |
| A: Molecular formula of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate) is C22H24O6. |
| Q: What is the CAS number of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate)? |
| A: CAS number of Methyl 2-Deoxy-D-erythro-pentopyranoside Bis(4-methylbenzoate) is 78103-18-1. |
| Q: What is the Chinese name of 78103-18-1? |
| A: Chinese name of 78103-18-1 is 78103-18-1. |