diethyl 2,2,4-trimethylpentanedioate structure
|
Common Name | diethyl 2,2,4-trimethylpentanedioate | ||
|---|---|---|---|---|
| CAS Number | 78108-06-2 | Molecular Weight | 230.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2,2,4-trimethylpentanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H22O4 |
|---|---|
| Molecular Weight | 230.30100 |
| Exact Mass | 230.15200 |
| PSA | 52.60000 |
| LogP | 2.16500 |
| InChIKey | RRLQZHYUNNJXPV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)CC(C)(C)C(=O)OCC |
|
~80%
diethyl 2,2,4-t... CAS#:78108-06-2 |
| Literature: Yamaguchi, Masahiko; Tsukamoto, Michinori; Hirao, Ichiro Chemistry Letters, 1984 , p. 375 - 376 |
|
~%
diethyl 2,2,4-t... CAS#:78108-06-2 |
| Literature: Weagley, Ronald J.; Gibson, Harry W. Synthesis, 1986 , # 7 p. 552 - 554 |
|
~%
diethyl 2,2,4-t... CAS#:78108-06-2 |
| Literature: Birch; Johnson Journal of the Chemical Society, 1951 , p. 1493,1495 |
| 2,2,4-Trimethyl-glutarsaeure-diaethylester |
| Pentanedioic acid,2,2,4-trimethyl-,diethyl ester |
| Diethyl 2,2,4-trimethylglutarate |
| 2,2,4-Trimethyl-glutarsaeure-diethylester |
| 2,2,4-trimethyl-glutaric acid diethyl ester |