Benzamide,N-(4-chlorophenyl)-2-hydroxy-3,5-dinitro- structure
|
Common Name | Benzamide,N-(4-chlorophenyl)-2-hydroxy-3,5-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 78154-60-6 | Molecular Weight | 337.67200 | |
| Density | 1.668g/cm3 | Boiling Point | 424.7ºC at 760 mmHg | |
| Molecular Formula | C13H8ClN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.6ºC | |
| Name | N-(4-chlorophenyl)-2-hydroxy-3,5-dinitrobenzamide |
|---|
| Density | 1.668g/cm3 |
|---|---|
| Boiling Point | 424.7ºC at 760 mmHg |
| Molecular Formula | C13H8ClN3O6 |
| Molecular Weight | 337.67200 |
| Flash Point | 210.6ºC |
| Exact Mass | 337.01000 |
| PSA | 140.97000 |
| LogP | 4.23370 |
| Index of Refraction | 1.729 |
| InChIKey | BISRCLVJCPIZKH-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |