2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid
Modify Date: 2026-09-27 21:36:06
2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid structure
|
Common Name | 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 781568-03-4 | Molecular Weight | 433.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H11NO8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H11NO8S2 |
|---|---|
| Molecular Weight | 433.4 |
| InChIKey | FDQVHBOJEDJTPE-UHFFFAOYSA-N |
| SMILES | O=C1C(c2ccc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3n2)=C(O)c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 781568-03-4? |
| A: Chinese name of 781568-03-4 is 781568-03-4. |
| Q: What is the SMILES notation of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid? |
| A: SMILES notation of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid is O=C1C(c2ccc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3n2)=C(O)c2ccccc21. |
| Q: What is the molecular formula of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid? |
| A: Molecular formula of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid is C18H11NO8S2. |
| Q: What is the molecular weight of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid? |
| A: Molecular weight of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid is 433.4. |
| Q: What is the InChIKey of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid? |
| A: InChIKey of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid is FDQVHBOJEDJTPE-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid? |
| A: The English name of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid is 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid. |
| Q: What is the CAS number of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid? |
| A: CAS number of 2-(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)-1,2-dihydroquinoline-6,8-disulfonic acid is 781568-03-4. |