Pyrido[2,3-d]pyrimidine-4(3H)-thione
![Pyrido[2,3-d]pyrimidine-4(3H)-thione Structure](https://image.chemsrc.com/caspic/339/78159-02-1.png)
Pyrido[2,3-d]pyrimidine-4(3H)-thione structure
|
Common Name | Pyrido[2,3-d]pyrimidine-4(3H)-thione | ||
|---|---|---|---|---|
| CAS Number | 78159-02-1 | Molecular Weight | 163.20000 | |
| Density | 1.47g/cm3 | Boiling Point | 344.4ºC at 760mmHg | |
| Molecular Formula | C7H5N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-pyrido[2,3-d]pyrimidine-4-thione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 344.4ºC at 760mmHg |
| Molecular Formula | C7H5N3S |
| Molecular Weight | 163.20000 |
| Flash Point | 162.1ºC |
| Exact Mass | 163.02000 |
| PSA | 73.66000 |
| LogP | 1.68740 |
| Index of Refraction | 1.772 |
| InChIKey | LQDZBRVMVSRDTC-UHFFFAOYSA-N |
| SMILES | S=c1nc[nH]c2ncccc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![4-(PIPERAZIN-1-YL)PYRIDO[2,3-D]PYRIMIDINE structure](https://image.chemsrc.com/caspic/394/853680-99-6.png)
CAS#:853680-99-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| LQDZBRVMVSRDTC-UHFFFAOYSA |
| 4-mercaptopyrido[2,3-d]pyrimidine |
| 3H-pyrido[2,3-d]pyrimidin-4-thione |
| 4-thiopyrido[2,3-d]pyrimidine |
| InChI=1/C7H5N3S/c11-7-5-2-1-3-8-6(5)9-4-10-7/h1-4H,(H,8,9,10,11) |
| Pyrido[2,3-d]pyrimidine-4(3H)-thione |
| 4-Mercaptopyrido<2,3-d>pyrimidin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1H-pyrido[2,3-d]pyrimidine-4-thione? |
| A: Molecular weight of 1H-pyrido[2,3-d]pyrimidine-4-thione is 163.20000. |
| Q: What English synonyms does 1H-pyrido[2,3-d]pyrimidine-4-thione have? |
| A: English synonyms of 1H-pyrido[2,3-d]pyrimidine-4-thione: LQDZBRVMVSRDTC-UHFFFAOYSA, 4-mercaptopyrido[2,3-d]pyrimidine, 3H-pyrido[2,3-d]pyrimidin-4-thione, 4-thiopyrido[2,3-d]pyrimidine, InChI=1/C7H5N3S/c11-7-5-2-1-3-8-6(5)9-4-10-7/h1-4H,(H,8,9,10,11), Pyrido[2,3-d]pyrimidine-4(3H)-thione, 4-Mercaptopyridopyrimidin. |
| Q: What is the Chinese name of 78159-02-1? |
| A: Chinese name of 78159-02-1 is 78159-02-1. |
| Q: What is the English name of 1H-pyrido[2,3-d]pyrimidine-4-thione? |
| A: The English name of 1H-pyrido[2,3-d]pyrimidine-4-thione is 1H-pyrido[2,3-d]pyrimidine-4-thione. |
| Q: What is the SMILES notation of 1H-pyrido[2,3-d]pyrimidine-4-thione? |
| A: SMILES notation of 1H-pyrido[2,3-d]pyrimidine-4-thione is S=c1nc[nH]c2ncccc12. |
| Q: What are the downstream products of 1H-pyrido[2,3-d]pyrimidine-4-thione? |
| A: Related downstream products(CAS) of 1H-pyrido[2,3-d]pyrimidine-4-thione: 853680-99-6. |
| Q: What is the InChIKey of 1H-pyrido[2,3-d]pyrimidine-4-thione? |
| A: InChIKey of 1H-pyrido[2,3-d]pyrimidine-4-thione is LQDZBRVMVSRDTC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1H-pyrido[2,3-d]pyrimidine-4-thione? |
| A: Molecular formula of 1H-pyrido[2,3-d]pyrimidine-4-thione is C7H5N3S. |
| Q: What is the CAS number of 1H-pyrido[2,3-d]pyrimidine-4-thione? |
| A: CAS number of 1H-pyrido[2,3-d]pyrimidine-4-thione is 78159-02-1. |
| Q: What is the boiling point of 1H-pyrido[2,3-d]pyrimidine-4-thione? |
| A: Boiling point of 1H-pyrido[2,3-d]pyrimidine-4-thione is 344.4ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |