1-ethyl-5,6-diphenylpyrazin-2-one structure
|
Common Name | 1-ethyl-5,6-diphenylpyrazin-2-one | ||
|---|---|---|---|---|
| CAS Number | 78174-92-2 | Molecular Weight | 276.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethyl-5,6-diphenylpyrazin-2-one |
|---|
| Molecular Formula | C18H16N2O |
|---|---|
| Molecular Weight | 276.33200 |
| Exact Mass | 276.12600 |
| PSA | 34.89000 |
| LogP | 3.59720 |
| InChIKey | KAJOQWPMCVFFTM-UHFFFAOYSA-N |
| SMILES | CCn1c(-c2ccccc2)c(-c2ccccc2)ncc1=O |
|
~%
1-ethyl-5,6-dip... CAS#:78174-92-2 |
| Literature: Nishio, Takehiko; Nakajima, Naoko; Kondo, Masaji; Omote, Yoshimori; Kaftory, Menahem Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 3 p. 391 - 396 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |