3-(Diethylamino)propyl 2,3-diphenylpropionate
Modify Date: 2025-10-08 21:59:36
3-(Diethylamino)propyl 2,3-diphenylpropionate structure
|
Common Name | 3-(Diethylamino)propyl 2,3-diphenylpropionate | ||
|---|---|---|---|---|
| CAS Number | 78218-34-5 | Molecular Weight | 339.47100 | |
| Density | 1.039g/cm3 | Boiling Point | 438.3ºC at 760 mmHg | |
| Molecular Formula | C22H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.9ºC | |
| Name | 3-(diethylamino)propyl 2,3-diphenylpropanoate |
|---|
| Density | 1.039g/cm3 |
|---|---|
| Boiling Point | 438.3ºC at 760 mmHg |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.47100 |
| Flash Point | 127.9ºC |
| Exact Mass | 339.22000 |
| PSA | 29.54000 |
| LogP | 4.28800 |
| Index of Refraction | 1.542 |
| InChIKey | NQDXHQITVYDOFD-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCOC(=O)C(Cc1ccccc1)c1ccccc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |