3-(1-ethyl-2-piperidyl)propyl benzoate hydrochloride
Modify Date: 2025-09-13 09:30:22
3-(1-ethyl-2-piperidyl)propyl benzoate hydrochloride structure
|
Common Name | 3-(1-ethyl-2-piperidyl)propyl benzoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 78219-43-9 | Molecular Weight | 311.84700 | |
| Density | N/A | Boiling Point | 368.9ºC at 760 mmHg | |
| Molecular Formula | C17H26ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.6ºC | |
| Name | 3-(1-ethylpiperidin-2-yl)propyl benzoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 368.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.84700 |
| Flash Point | 119.6ºC |
| Exact Mass | 311.16500 |
| PSA | 29.54000 |
| LogP | 4.23790 |
| InChIKey | KWYXYBADTSCGOQ-UHFFFAOYSA-N |
| SMILES | CCN1CCCCC1CCCOC(=O)c1ccccc1.Cl |
| HS Code | 2933399090 |
|---|
|
~%
3-(1-ethyl-2-pi... CAS#:78219-43-9 |
| Literature: Tullock; McElvain Journal of the American Chemical Society, 1939 , vol. 61, p. 961,963 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Piperidinepropanol,1-ethyl-,benzoate,hydrochloride |