3-(1-butylpiperidin-2-yl)propyl benzoate,hydrochloride structure
|
Common Name | 3-(1-butylpiperidin-2-yl)propyl benzoate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 78219-64-4 | Molecular Weight | 339.90000 | |
| Density | N/A | Boiling Point | 398.1ºC at 760 mmHg | |
| Molecular Formula | C19H30ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.5ºC | |
| Name | 3-(1-butylpiperidin-2-yl)propyl benzoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 398.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H30ClNO2 |
| Molecular Weight | 339.90000 |
| Flash Point | 121.5ºC |
| Exact Mass | 339.19700 |
| PSA | 29.54000 |
| LogP | 5.01810 |
| InChIKey | FJGPJTRFSBZRDW-UHFFFAOYSA-N |
| SMILES | CCCCN1CCCCC1CCCOC(=O)c1ccccc1.Cl |
|
~%
3-(1-butylpiper... CAS#:78219-64-4 |
| Literature: Tullock; McElvain Journal of the American Chemical Society, 1939 , vol. 61, p. 961,963 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Piperidinepropanol,1-butyl-,benzoate,hydrochloride |