1-[(2,5-dimethoxyphenyl)methyl]-4-hexyl-piperazine-2,3-dione structure
|
Common Name | 1-[(2,5-dimethoxyphenyl)methyl]-4-hexyl-piperazine-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 78220-13-0 | Molecular Weight | 348.43700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H28N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(2,5-dimethoxyphenyl)methyl]-4-hexylpiperazine-2,3-dione |
|---|
| Molecular Formula | C19H28N2O4 |
|---|---|
| Molecular Weight | 348.43700 |
| Exact Mass | 348.20500 |
| PSA | 59.08000 |
| LogP | 2.33070 |
| InChIKey | UOZPUEZCWFSGCH-UHFFFAOYSA-N |
| SMILES | CCCCCCN1CCN(Cc2cc(OC)ccc2OC)C(=O)C1=O |
| HS Code | 2933599090 |
|---|
|
~%
1-[(2,5-dimetho... CAS#:78220-13-0 |
| Literature: Hori; Yoshida; Murakami; Takeno; Nakano; Nitta; Tsuda; Kishimoto; Saikawa Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 3 p. 684 - 698 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |