2-Amino-8-chloro-1,2,3,4-tetrahydro-2-naphthalenecarboxamide structure
|
Common Name | 2-Amino-8-chloro-1,2,3,4-tetrahydro-2-naphthalenecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 782425-00-7 | Molecular Weight | 224.68700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Amino-8-chloro-1,2,3,4-tetrahydro-2-naphthalenecarboxamide |
|---|
| Molecular Formula | C11H13ClN2O |
|---|---|
| Molecular Weight | 224.68700 |
| Exact Mass | 224.07200 |
| PSA | 70.10000 |
| LogP | 2.86150 |
| InChIKey | LXWLBLVBZVLAJV-UHFFFAOYSA-N |
| SMILES | NC(=O)C1(N)CCc2cccc(Cl)c2C1 |
|
~%
2-Amino-8-chlor... CAS#:782425-00-7 |
| Literature: Cordi; Lacoste; Descombes; Courchay; Vanhoutte; Laubie; Verbeuren Journal of Medicinal Chemistry, 1995 , vol. 38, # 20 p. 4056 - 4069 |
|
~%
2-Amino-8-chlor... CAS#:782425-00-7 |
| Literature: Cordi; Lacoste; Descombes; Courchay; Vanhoutte; Laubie; Verbeuren Journal of Medicinal Chemistry, 1995 , vol. 38, # 20 p. 4056 - 4069 |