5-amino-2-(3-methylpiperidin-1-yl)benzoic acid structure
|
Common Name | 5-amino-2-(3-methylpiperidin-1-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 78243-67-1 | Molecular Weight | 234.29400 | |
| Density | 1.192g/cm3 | Boiling Point | 451.159ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.653ºC | |
| Name | 5-amino-2-(3-methylpiperidin-1-yl)benzoic acid |
|---|
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 451.159ºC at 760 mmHg |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.29400 |
| Flash Point | 226.653ºC |
| Exact Mass | 234.13700 |
| PSA | 66.56000 |
| LogP | 2.84950 |
| Index of Refraction | 1.597 |
| InChIKey | HLHXVRSOPLAEAC-UHFFFAOYSA-N |
| SMILES | CC1CCCN(c2ccc(N)cc2C(=O)O)C1 |
| HS Code | 2933399090 |
|---|
|
~%
5-amino-2-(3-me... CAS#:78243-67-1 |
| Literature: Grell, Wolfgang; Hurnaus, Rudolf Journal of Medicinal Chemistry, 1998 , vol. 41, # 26 p. 5219 - 5246 |
|
~%
5-amino-2-(3-me... CAS#:78243-67-1 |
| Literature: Grell, Wolfgang; Hurnaus, Rudolf Journal of Medicinal Chemistry, 1998 , vol. 41, # 26 p. 5219 - 5246 |
|
~%
5-amino-2-(3-me... CAS#:78243-67-1 |
| Literature: Grell, Wolfgang; Hurnaus, Rudolf Journal of Medicinal Chemistry, 1998 , vol. 41, # 26 p. 5219 - 5246 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |