6(5H)-Phenanthridinone,2-nitro- structure
|
Common Name | 6(5H)-Phenanthridinone,2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 78256-30-1 | Molecular Weight | 240.21400 | |
| Density | 1.409g/cm3 | Boiling Point | 360.4ºC at 760 mmHg | |
| Molecular Formula | C13H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.8ºC | |
| Name | 2-nitro-5H-phenanthridin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.409g/cm3 |
|---|---|
| Boiling Point | 360.4ºC at 760 mmHg |
| Molecular Formula | C13H8N2O3 |
| Molecular Weight | 240.21400 |
| Flash Point | 171.8ºC |
| Exact Mass | 240.05300 |
| PSA | 78.68000 |
| LogP | 3.11270 |
| Index of Refraction | 1.672 |
| InChIKey | KLNFQJDLPUPRJZ-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ccc([N+](=O)[O-])cc2c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-nitro-6(5H)-phenanthridinone |
| 2-nitrophenanthridin-6(5H)-one |
| 3-Nitro-phenanthridon |
| 2-Nitro-6(5H)-phenanthridinon |
| 2-nitrophenanthridone |