3-diphenylphosphoryl-9-hydroxynonan-4-one structure
|
Common Name | 3-diphenylphosphoryl-9-hydroxynonan-4-one | ||
|---|---|---|---|---|
| CAS Number | 78266-85-0 | Molecular Weight | 358.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H27O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-diphenylphosphoryl-9-hydroxynonan-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H27O3P |
|---|---|
| Molecular Weight | 358.41100 |
| Exact Mass | 358.17000 |
| PSA | 64.18000 |
| LogP | 3.90090 |
| InChIKey | UGVPEOXPFRXRJX-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)CCCCCO)P(=O)(c1ccccc1)c1ccccc1 |
|
~82%
3-diphenylphosp... CAS#:78266-85-0 |
| Literature: Buss, Antony D.; Warren, Stuart Journal of the Chemical Society, Chemical Communications, 1981 , # 3 p. 100 - 101 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-diphenylphosphinoyl-9-hydroxynonan-4-one |