2,4'-DIBROMOBENZOPHENONE structure
|
Common Name | 2,4'-DIBROMOBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 78281-59-1 | Molecular Weight | 340.01000 | |
| Density | 1.701g/cm3 | Boiling Point | 382.498ºC at 760 mmHg | |
| Molecular Formula | C13H8Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.345ºC | |
| Name | (2-bromophenyl)-(4-bromophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.701g/cm3 |
|---|---|
| Boiling Point | 382.498ºC at 760 mmHg |
| Molecular Formula | C13H8Br2O |
| Molecular Weight | 340.01000 |
| Flash Point | 120.345ºC |
| Exact Mass | 337.89400 |
| PSA | 17.07000 |
| LogP | 4.44260 |
| Index of Refraction | 1.633 |
| InChIKey | UVBUYAPAJGPEMU-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Br)cc1)c1ccccc1Br |
| HS Code | 2914700090 |
|---|
|
~%
2,4'-DIBROMOBEN... CAS#:78281-59-1 |
| Literature: Montagne Recueil des Travaux Chimiques des Pays-Bas, 1910 , vol. 29, p. 153 |
|
~%
2,4'-DIBROMOBEN... CAS#:78281-59-1 |
| Literature: Heidenreich Chemische Berichte, 1894 , vol. 27, p. 1454 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| (2-bromophenyl)(4-bromophenyl)-methanone |
| Methanone,(2-bromophenyl)(4-bromophenyl) |
| 2,4A'A inverted exclamation markA'A-DIBROMOBENZOPHENONE |
| (2-Brom-phenyl)-(4-brom-phenyl)-keton |
| 2,4'-Dibrom-benzophenon |
| 2,4'-DIBROMOBENZOPHENONE |