9H-Purin-6-amine,2,8-dichloro-N-(2-furanylmethyl) structure
|
Common Name | 9H-Purin-6-amine,2,8-dichloro-N-(2-furanylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 78295-88-2 | Molecular Weight | 284.10100 | |
| Density | 1.81g/cm3 | Boiling Point | 407.7ºC at 760 mmHg | |
| Molecular Formula | C10H7Cl2N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.4ºC | |
| Name | 2,8-dichloro-N-(furan-2-ylmethyl)-7H-purin-6-amine |
|---|
| Density | 1.81g/cm3 |
|---|---|
| Boiling Point | 407.7ºC at 760 mmHg |
| Molecular Formula | C10H7Cl2N5O |
| Molecular Weight | 284.10100 |
| Flash Point | 200.4ºC |
| Exact Mass | 283.00300 |
| PSA | 79.63000 |
| LogP | 2.93780 |
| Index of Refraction | 1.797 |
| InChIKey | MPKAGGOOAUOGAS-UHFFFAOYSA-N |
| SMILES | Clc1nc(NCc2ccco2)c2[nH]c(Cl)nc2n1 |
|
~%
9H-Purin-6-amin... CAS#:78295-88-2 |
| Literature: Breshears et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3789,3790 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |