4,4,5,5-tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole,hydrochloride structure
|
Common Name | 4,4,5,5-tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 78302-26-8 | Molecular Weight | 263.15600 | |
| Density | 1.412g/cm3 | Boiling Point | 421.517ºC at 760 mmHg | |
| Molecular Formula | C11H8Cl2D4N2O | Melting Point | 229-231ºC | |
| MSDS | N/A | Flash Point | 208.726ºC | |
| Name | 4,4,5,5-tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.412g/cm3 |
|---|---|
| Boiling Point | 421.517ºC at 760 mmHg |
| Melting Point | 229-231ºC |
| Molecular Formula | C11H8Cl2D4N2O |
| Molecular Weight | 263.15600 |
| Flash Point | 208.726ºC |
| Exact Mass | 262.05800 |
| PSA | 33.62000 |
| LogP | 2.52680 |
| Index of Refraction | 1.611 |
| InChIKey | DWWHMKBNNNZGHF-NXMSQKFDSA-N |
| SMILES | CC(Oc1c(Cl)cccc1Cl)C1=NCCN1.Cl |
|
~%
4,4,5,5-tetrade... CAS#:78302-26-8 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 52, # 10 p. 431 - 434 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Britlofex-d4 |
| 2-[1-(2,6-Dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole-d4 Hydrochloride |
| Loxacor-d4 |
| Ba-168-d4 |
| Lofetensin-d4 |
| Lofexidine-d4 Hydrochloride |