2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one
Modify Date: 2026-09-28 17:59:52
2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one structure
|
Common Name | 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one | ||
|---|---|---|---|---|
| CAS Number | 784-61-2 | Molecular Weight | 232.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N2O3 |
|---|---|
| Molecular Weight | 232.23 |
| InChIKey | MEBPQBQIDNSFGQ-UHFFFAOYSA-N |
| SMILES | O=c1nc(N2CCOCC2)oc2ccccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one? |
| A: Molecular formula of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one is C12H12N2O3. |
| Q: What is the CAS number of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one? |
| A: CAS number of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one is 784-61-2. |
| Q: What is the SMILES notation of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one? |
| A: SMILES notation of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one is O=c1nc(N2CCOCC2)oc2ccccc12. |
| Q: What is the molecular weight of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one? |
| A: Molecular weight of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one is 232.23. |
| Q: What is the English name of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one? |
| A: The English name of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one is 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one. |
| Q: What is the Chinese name of 784-61-2? |
| A: Chinese name of 784-61-2 is 784-61-2. |
| Q: What is the InChIKey of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one? |
| A: InChIKey of 2-(4-morpholinyl)-4H-1,3-benzoxazin-4-one is MEBPQBQIDNSFGQ-UHFFFAOYSA-N. |