4-[4-(1-PYRROLIDINYL)PHENYL]-1,3-THIAZOL-2-YLAMINE structure
|
Common Name | 4-[4-(1-PYRROLIDINYL)PHENYL]-1,3-THIAZOL-2-YLAMINE | ||
|---|---|---|---|---|
| CAS Number | 784136-89-6 | Molecular Weight | 245.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15N3S |
|---|---|
| Molecular Weight | 245.34300 |
| Exact Mass | 245.09900 |
| PSA | 70.39000 |
| LogP | 3.63870 |
| InChIKey | LAAAYLCXBDADNM-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccc(N3CCCC3)cc2)cs1 |
| HS Code | 2934100090 |
|---|
|
~97%
4-[4-(1-PYRROLI... CAS#:784136-89-6 |
| Literature: Annadurai, Sivakumar; Martinez, Rogelio; Canney, Daniel J.; Eidem, Tess; Dunman, Paul M.; Abou-Gharbia, Magid Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 24 p. 7719 - 7725 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Amino-4-(4-pyrrolidin-1-ylphenyl)-1,3-thiazole |
| 4-(4-pyrrolidin-1-yl-phenyl)-thiazol-2-yl-amine |
| pyrrolidinylphenylthiazolylamine |