PCG (combination) structure
|
Common Name | PCG (combination) | ||
|---|---|---|---|---|
| CAS Number | 78457-01-9 | Molecular Weight | 301.59400 | |
| Density | N/A | Boiling Point | 205ºC at 760 mmHg | |
| Molecular Formula | C11H15Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 82.2ºC | |
| Name | 2-methoxyphenol,1,1,1-trichloro-2-methylpropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 205ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H15Cl3O3 |
| Molecular Weight | 301.59400 |
| Flash Point | 82.2ºC |
| Exact Mass | 300.00900 |
| PSA | 49.69000 |
| LogP | 3.52830 |
| InChIKey | XHXDQAYWNKNTDD-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C(Cl)(Cl)Cl.COc1ccccc1O |
| 1,1,1-trichloro-2-methyl-propan-2-ol |
| Phenol,2-methoxy-,mixt. with phenol and 1,1,1-trichloro-2-methyl-2-propanol |