2-butylsulfanyl-3-chloronaphthalene-1,4-dione structure
|
Common Name | 2-butylsulfanyl-3-chloronaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 78490-05-8 | Molecular Weight | 280.77000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-butylsulfanyl-3-chloronaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13ClO2S |
|---|---|
| Molecular Weight | 280.77000 |
| Exact Mass | 280.03200 |
| PSA | 59.44000 |
| LogP | 4.04930 |
| InChIKey | ZDDWSZGXFGEDGT-UHFFFAOYSA-N |
| SMILES | CCCCSC1=C(Cl)C(=O)c2ccccc2C1=O |
|
~%
2-butylsulfanyl... CAS#:78490-05-8 |
| Literature: Fieser; Brown Journal of the American Chemical Society, 1949 , vol. 71, p. 3615 |
|
~%
2-butylsulfanyl... CAS#:78490-05-8 |
| Literature: Fieser; Brown Journal of the American Chemical Society, 1949 , vol. 71, p. 3615 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Butylthio-3-chloro-1,4-naphthoquinone |
| 3-Butylmercapto-2-chlor-1,4-naphthochinon |