N-trans-Feruloyl-3-methoxytyramine structure
|
Common Name | N-trans-Feruloyl-3-methoxytyramine | ||
|---|---|---|---|---|
| CAS Number | 78510-19-7 | Molecular Weight | 343.374 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 618.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.1±31.5 °C | |
Use of N-trans-Feruloyl-3-methoxytyramineN-trans-Feruloyl-3-methyldopamine (compound 4) is an anticancer compound isolated from Alternanthera philoxeroides. N-trans-Feruloyl-3-methyldopamine is cytotoxic to HeLa cells, with an inhibition rate of 72.2% at a concentration of 30 μg/mL[1]. |
| Name | (2E)-3-(4-Hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxypheny l)ethyl]acrylamide |
|---|---|
| Synonym | More Synonyms |
| Description | N-trans-Feruloyl-3-methyldopamine (compound 4) is an anticancer compound isolated from Alternanthera philoxeroides. N-trans-Feruloyl-3-methyldopamine is cytotoxic to HeLa cells, with an inhibition rate of 72.2% at a concentration of 30 μg/mL[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 618.9±55.0 °C at 760 mmHg |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.374 |
| Flash Point | 328.1±31.5 °C |
| Exact Mass | 343.141968 |
| PSA | 88.02000 |
| LogP | 1.71 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | GRXBVKANHNUZNL-VMPITWQZSA-N |
| SMILES | COc1cc(C=CC(=O)NCCc2ccc(O)c(OC)c2)ccc1O |
| N-trans-feruloyl-3-O-methyldopamine |
| (2E)-3-(4-Hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]acrylamide |
| 3-(4-hydroxy-3-methoxyphenyl)-N-(2-(4-hydroxy-3-methoxyphenyl)ethyl)-2-propenamide |
| N-trans-cinnamyltyramine |
| (2E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]prop-2-enamide |
| 2-Propenamide, 3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxy-3-methoxyphenyl)ethyl]-, (2E)- |
| N-trans-feruloy-3-O-methyldopamine |
| N-trans-cinnamoyltyramine |
| trans-N-feruloyl-3-O-methyldopamine |
| N-trans-Feruloylmethoxytyramine |