1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxypropane structure
|
Common Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxypropane | ||
|---|---|---|---|---|
| CAS Number | 78522-49-3 | Molecular Weight | 636.07800 | |
| Density | 1.764g/cm3 | Boiling Point | 222.8ºC at 760 mmHg | |
| Molecular Formula | C11F24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.3ºC | |
| Name | 1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-[1,1,1,2,3,3-hexafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propan-2-yl]oxypropane |
|---|
| Density | 1.764g/cm3 |
|---|---|
| Boiling Point | 222.8ºC at 760 mmHg |
| Molecular Formula | C11F24O3 |
| Molecular Weight | 636.07800 |
| Flash Point | 95.3ºC |
| Exact Mass | 635.94600 |
| PSA | 27.69000 |
| LogP | 7.62350 |
| Index of Refraction | 1.273 |
| InChIKey | GYVNCAVOUACSID-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
|
~99%
1,1,1,2,3,3-hex... CAS#:78522-49-3 |
| Literature: Zakharov, V. Yu.; Denisov, A. K.; Novikova, M. D. Russian Journal of Organic Chemistry, 1994 , vol. 30, # 12 p. 1942 - 1945 Zhurnal Organicheskoi Khimii, 1994 , vol. 30, # 12 p. 1844 - 1846 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |