3-phenylpentanediamide structure
|
Common Name | 3-phenylpentanediamide | ||
|---|---|---|---|---|
| CAS Number | 78533-83-2 | Molecular Weight | 206.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-phenylpentanediamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H14N2O2 |
|---|---|
| Molecular Weight | 206.24100 |
| Exact Mass | 206.10600 |
| PSA | 88.16000 |
| LogP | 2.82040 |
| InChIKey | INNIENBZXVVRGC-UHFFFAOYSA-N |
| SMILES | NC(=O)CC(CC(N)=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~61%
3-phenylpentane... CAS#:78533-83-2 |
| Literature: Weinhardt, Klaus; Wallach, Marshall B.; Marx, Michael Journal of Medicinal Chemistry, 1985 , vol. 28, # 6 p. 694 - 698 |
|
~91%
3-phenylpentane... CAS#:78533-83-2 |
| Literature: Brandner, Alexander Synthesis, 1982 , # 11 p. 973 - 974 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Pentanediamide,3-phenyl |
| 3-phenylglutaramide |
| 3-Phenylpentandiamid |