1,5-diamino-4,8-dihydroxy-2-(4-propoxyphenyl)anthracene-9,10-dione structure
|
Common Name | 1,5-diamino-4,8-dihydroxy-2-(4-propoxyphenyl)anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 78536-01-3 | Molecular Weight | 404.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-diamino-4,8-dihydroxy-2-(4-propoxyphenyl)anthracene-9,10-dione |
|---|
| Molecular Formula | C23H20N2O5 |
|---|---|
| Molecular Weight | 404.41500 |
| Exact Mass | 404.13700 |
| PSA | 135.87000 |
| LogP | 4.65580 |
| InChIKey | VQKDKIBRXNYBAX-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(-c2cc(O)c3c(c2N)C(=O)c2c(O)ccc(N)c2C3=O)cc1 |
|
~%
1,5-diamino-4,8... CAS#:78536-01-3 |
| Literature: Cognard, J.; Phan, T. Hieu Molecular Crystals and Liquid Crystals (1969-1991), 1981 , vol. 70, p. 1 - 20 |
|
~%
1,5-diamino-4,8... CAS#:78536-01-3 |
| Literature: Cognard; Hieu Phan; Basturk Molecular crystals and liquid crystals, 1983 , vol. 91, # 3-4 p. 327 - 340 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |