2-cyclopentylethyl 4-methylbenzenesulfonate
2-cyclopentylethyl 4-methylbenzenesulfonate structure
|
Common Name | 2-cyclopentylethyl 4-methylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 786-33-4 | Molecular Weight | 268.37200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-cyclopentylethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H20O3S |
|---|---|
| Molecular Weight | 268.37200 |
| Exact Mass | 268.11300 |
| PSA | 51.75000 |
| LogP | 4.36140 |
| InChIKey | NIUNKLUXTJAZCM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCC2CCCC2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:24321-78-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Cyclopentyl-1-[p-toluolsulfonyloxy]]-aethan |
| p-Toluolsulfonsaeure-2-(cyclopentyl)-ethylester |
| p-Toluolsulfonat des 2-Cyclopentyl-aethanol-(1) |
| (2-cyclopentyl)ethyl toluenesulfonate |
| toluene-4-sulfonic acid 2-cyclopentyl-ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 786-33-4? |
| A: Chinese name of 786-33-4 is 786-33-4. |
| Q: What are the downstream products of 2-cyclopentylethyl 4-methylbenzenesulfonate? |
| A: Related downstream products(CAS) of 2-cyclopentylethyl 4-methylbenzenesulfonate: 24321-78-6. |
| Q: What is the InChIKey of 2-cyclopentylethyl 4-methylbenzenesulfonate? |
| A: InChIKey of 2-cyclopentylethyl 4-methylbenzenesulfonate is NIUNKLUXTJAZCM-UHFFFAOYSA-N. |
| Q: What English synonyms does 2-cyclopentylethyl 4-methylbenzenesulfonate have? |
| A: English synonyms of 2-cyclopentylethyl 4-methylbenzenesulfonate: 2-Cyclopentyl-1-[p-toluolsulfonyloxy]]-aethan, p-Toluolsulfonsaeure-2-(cyclopentyl)-ethylester, p-Toluolsulfonat des 2-Cyclopentyl-aethanol-(1), (2-cyclopentyl)ethyl toluenesulfonate, toluene-4-sulfonic acid 2-cyclopentyl-ethyl ester. |
| Q: What is the CAS number of 2-cyclopentylethyl 4-methylbenzenesulfonate? |
| A: CAS number of 2-cyclopentylethyl 4-methylbenzenesulfonate is 786-33-4. |
| Q: What is the LogP of 2-cyclopentylethyl 4-methylbenzenesulfonate? |
| A: LogP of 2-cyclopentylethyl 4-methylbenzenesulfonate is 4.36140. |
| Q: What is the molecular formula of 2-cyclopentylethyl 4-methylbenzenesulfonate? |
| A: Molecular formula of 2-cyclopentylethyl 4-methylbenzenesulfonate is C14H20O3S. |
| Q: What is the molecular weight of 2-cyclopentylethyl 4-methylbenzenesulfonate? |
| A: Molecular weight of 2-cyclopentylethyl 4-methylbenzenesulfonate is 268.37200. |
| Q: What is the polar surface area (PSA) of 2-cyclopentylethyl 4-methylbenzenesulfonate? |
| A: Polar surface area (PSA) of 2-cyclopentylethyl 4-methylbenzenesulfonate is 51.75000. |
| Q: What is the SMILES notation of 2-cyclopentylethyl 4-methylbenzenesulfonate? |
| A: SMILES notation of 2-cyclopentylethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCC2CCCC2)cc1. |