10-(Chloroacetyl)-10H-phenothiazine structure
|
Common Name | 10-(Chloroacetyl)-10H-phenothiazine | ||
|---|---|---|---|---|
| CAS Number | 786-50-5 | Molecular Weight | 275.75300 | |
| Density | 1.383g/cm3 | Boiling Point | 498.6ºC at 760 mmHg | |
| Molecular Formula | C14H10ClNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.3ºC | |
| Name | 2-chloro-1-phenothiazin-10-ylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.383g/cm3 |
|---|---|
| Boiling Point | 498.6ºC at 760 mmHg |
| Molecular Formula | C14H10ClNOS |
| Molecular Weight | 275.75300 |
| Flash Point | 255.3ºC |
| Exact Mass | 275.01700 |
| PSA | 45.61000 |
| LogP | 4.11970 |
| Index of Refraction | 1.676 |
| InChIKey | NVRFGQJNKQLUPU-UHFFFAOYSA-N |
| SMILES | O=C(CCl)N1c2ccccc2Sc2ccccc21 |
| HS Code | 2934999090 |
|---|
|
~92%
10-(Chloroacety... CAS#:786-50-5 |
| Literature: Sarmiento, Gabriela P.; Vitale, Roxana G.; Afeltra, Javier; Moltrasio, Graciela Y.; Moglioni, Albertina G. European Journal of Medicinal Chemistry, 2011 , vol. 46, # 1 p. 101 - 105 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-1-phenothiazin-10-ylethan-1-one |
| N10-chloroacetyl-10H-phenothiazine |