N-(2-fluoroethyldiazenyl)-4-nitro-aniline structure
|
Common Name | N-(2-fluoroethyldiazenyl)-4-nitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 78604-30-5 | Molecular Weight | 212.18100 | |
| Density | 1.36g/cm3 | Boiling Point | 326.5ºC at 760 mmHg | |
| Molecular Formula | C8H9FN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.3ºC | |
| Name | N-(2-fluoroethyldiazenyl)-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 326.5ºC at 760 mmHg |
| Molecular Formula | C8H9FN4O2 |
| Molecular Weight | 212.18100 |
| Flash Point | 151.3ºC |
| Exact Mass | 212.07100 |
| PSA | 82.57000 |
| LogP | 2.93960 |
| Index of Refraction | 1.578 |
| InChIKey | HTBGKQCYRJLMNQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=NCCF)cc1 |
|
~%
N-(2-fluoroethy... CAS#:78604-30-5 |
| Literature: Lown; Singh Canadian Journal of Chemistry, 1981 , vol. 59, # 9 p. 1347 - 1356 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(p-nitrophenyl)-3-(2-fluoroethyl)triazene |
| N-(2-FLUOROETHYLDIAZENYL)-4-NITRO-ANILINE |