5-(5-chloro-1,3-benzoxazol-2-yl)-3H-1,3,4-oxadiazol-2-one structure
|
Common Name | 5-(5-chloro-1,3-benzoxazol-2-yl)-3H-1,3,4-oxadiazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 78620-15-2 | Molecular Weight | 237.59900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(5-chloro-1,3-benzoxazol-2-yl)-3H-1,3,4-oxadiazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H4ClN3O3 |
|---|---|
| Molecular Weight | 237.59900 |
| Exact Mass | 236.99400 |
| PSA | 85.18000 |
| LogP | 2.23680 |
| InChIKey | NXIPAFMSTLUXKR-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(-c2nc3cc(Cl)ccc3o2)o1 |
|
~%
5-(5-chloro-1,3... CAS#:78620-15-2 |
| Literature: Musser, John H.; Brown, Richard E.; Loev, Bernard; Bailey, Kevin; Jones, Howard; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 2 p. 121 - 125 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Concentration required to inhibit antigen-induced release of histamine (AIR) by 50% f...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL766097
|
|
Name: Inhibition of antigen-induced release of histamine (AIR) by 50% in rat dosed perorall...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL777161
|
| 1,3,4-Oxadiazol-2(3H)-one,5-(5-chloro-2-benzoxazolyl) |
| 5-chloro-2-(2-oxo-3H-1,3,4-oxadiazole-5-yl)benzoxazole |
| CTK2G5117 |
| AGN-PC-00KV38 |