5-(1-benzofuran-2-yl)-3H-1,3,4-oxadiazol-2-one structure
|
Common Name | 5-(1-benzofuran-2-yl)-3H-1,3,4-oxadiazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 78620-33-4 | Molecular Weight | 202.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(1-benzofuran-2-yl)-3H-1,3,4-oxadiazol-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H6N2O3 |
|---|---|
| Molecular Weight | 202.16600 |
| Exact Mass | 202.03800 |
| PSA | 72.29000 |
| LogP | 2.18840 |
| InChIKey | VXCVSCVIAKVKGH-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(-c2cc3ccccc3o2)o1 |
|
~85%
5-(1-benzofuran... CAS#:78620-33-4 |
| Literature: Musser, John H.; Brown, Richard E.; Loev, Bernard; Bailey, Kevin; Jones, Howard; et al. Journal of Medicinal Chemistry, 1984 , vol. 27, # 2 p. 121 - 125 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Concentration required to inhibit antigen-induced release of histamine (AIR) by 50% f...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL766097
|
|
Name: Inhibition of antigen-induced release of histamine (AIR) by 50% in rat dosed perorall...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL777161
|
| CTK2G5110 |
| 1,3,4-Oxadiazol-2(3H)-one,5-(2-benzofuranyl) |
| 2-(2,3-dihydro-2-oxo-1,3,4-oxadizol-5-yl)benzofuran |
| AGN-PC-00KV3K |
| 2-(2-oxo-3H-1,3,4-oxadiazole-5-yl)benzofuran |