(Z)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine structure
|
Common Name | (Z)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine | ||
|---|---|---|---|---|
| CAS Number | 78628-81-6 | Molecular Weight | 291.430 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 417.9±33.0 °C at 760 mmHg | |
| Molecular Formula | C21H25N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.7±22.3 °C | |
| Name | (Z)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 417.9±33.0 °C at 760 mmHg |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.430 |
| Flash Point | 183.7±22.3 °C |
| Exact Mass | 291.198700 |
| PSA | 3.24000 |
| LogP | 6.61 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | DOMXUEMWDBAQBQ-UITAMQMPSA-N |
| SMILES | CN(CC=CC#CC(C)(C)C)Cc1cccc2ccccc12 |
|
~%
Detail
|
| Literature: DINAMITE DIPHARMA S.P.A., IN ABBREVIATED FORM DIPHARMA S.P.A. Patent: WO2004/50604 A2, 2004 ; Location in patent: Page 7 ; |
|
~64%
(Z)-N,6,6-trime... CAS#:78628-81-6 |
| Literature: Kazakov; Golosov Pharmaceutical Chemistry Journal, 2006 , vol. 40, # 8 p. 452 - 454 |
|
~%
(Z)-N,6,6-trime... CAS#:78628-81-6 |
| Literature: Stuetz, Anton; Petranyi, Gabor Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1539 - 1543 |
|
~%
(Z)-N,6,6-trime... CAS#:78628-81-6 |
| Literature: Stuetz, Anton; Petranyi, Gabor Journal of Medicinal Chemistry, 1984 , vol. 27, # 12 p. 1539 - 1543 |
| (Z)-N-(6,6-dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethanamine |
| Terbinafine hydrochloride specified impurity B [EP] |
| Terbinafine,(Z) |
| Terbinafine related compound B free base |
| AC1LU7MV |
| (Z)-N,6,6-trimethyl-N-(naphth-1-ylmethyl)hept-2-en-4-yn-1-amine |
| N-(6,6-dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthylmethyl amine |
| 1-Naphthalenemethanamine, N-[(2Z)-6,6-dimethyl-2-hepten-4-yn-1-yl]-N-methyl- |
| Terbinafine hydrochloride impurity,cis-terbinafine-[USP] |
| cis-Terbinafine |
| 1-Naphthalenemethanamine,N-((2Z)-6,6-dimethyl-2-hepten-4-ynyl)-N-methyl |
| (2Z)-N,6,6-Trimethyl-N-(1-naphthylmethyl)-2-hepten-4-yn-1-amine |
| UNII-S76S370M70 |
| (2Z)-N,6,6-Trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine |