[(4-methoxyphenyl)methyl] hydrogen (4-hydroxyphenyl)malonate
Modify Date: 2025-08-25 17:56:57
![[(4-methoxyphenyl)methyl] hydrogen (4-hydroxyphenyl)malonate Structure](https://image.chemsrc.com/caspic/278/78641-40-4.png)
[(4-methoxyphenyl)methyl] hydrogen (4-hydroxyphenyl)malonate structure
|
Common Name | [(4-methoxyphenyl)methyl] hydrogen (4-hydroxyphenyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 78641-40-4 | Molecular Weight | 316.30500 | |
| Density | 1.333g/cm3 | Boiling Point | 519.6ºC at 760 mmHg | |
| Molecular Formula | C17H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191ºC | |
| Name | 2-(4-hydroxyphenyl)-3-[(4-methoxyphenyl)methoxy]-3-oxopropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 519.6ºC at 760 mmHg |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.30500 |
| Flash Point | 191ºC |
| Exact Mass | 316.09500 |
| PSA | 93.06000 |
| LogP | 2.31240 |
| Index of Refraction | 1.602 |
| InChIKey | JHALLYTYXLWETG-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)C(C(=O)O)c2ccc(O)cc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 278-959-1 |
| ((4-Methoxyphenyl)methyl) hydrogen (4-hydroxyphenyl)malonate |
| 2-(4-Hydroxyphenyl)-3-((4-methoxybenzyl)oxy)-3-oxopropanoic acid |
| 2-(4-Hydroxyphenyl)propanedioic acid 1-[(4-methoxyphenyl)methyl] ester |
| I01-9771 |