ethyl 4,6-dichloro-3-hydroxy-2-methylbenzoate structure
|
Common Name | ethyl 4,6-dichloro-3-hydroxy-2-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 78668-11-8 | Molecular Weight | 249.09100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4,6-dichloro-3-hydroxy-2-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10Cl2O3 |
|---|---|
| Molecular Weight | 249.09100 |
| Exact Mass | 248.00100 |
| PSA | 46.53000 |
| LogP | 3.18410 |
| InChIKey | KBZWVYCNLUVXMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(Cl)cc(Cl)c(O)c1C |
|
~83%
ethyl 4,6-dichl... CAS#:78668-11-8 |
| Literature: Gillespie, Roger J.; Murray-Rust, Judith; Murray-Rust, Peter; Porter, Alexander E. A. Tetrahedron, 1981 , vol. 37, p. 743 - 746 |
|
~61%
ethyl 4,6-dichl... CAS#:78668-11-8 |
| Literature: Vuorinen, Eino; Modro, Tomasz A. Phosphorus, Sulfur and Silicon and the Related Elements, 1991 , vol. 63, # 1/2 p. 161 - 170 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| CTK2G5050 |
| 2,4-dichloro-5-ethoxycarbonyl-6-methylphenol |
| ethyl-2,4-dichloro-5-hydroxy-6-methylbenzoate |
| Benzoic acid,4,6-dichloro-3-hydroxy-2-methyl-,ethyl ester |