2-(5-methoxy-2,3-dihydro-1H-inden-2-yl)acetic acid structure
|
Common Name | 2-(5-methoxy-2,3-dihydro-1H-inden-2-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 78698-48-3 | Molecular Weight | 206.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-methoxy-2,3-dihydro-1H-inden-2-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O3 |
|---|---|
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 46.53000 |
| LogP | 1.88470 |
| InChIKey | VKXDSGNKQHBEPG-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)CC(CC(=O)O)C2 |
| HS Code | 2918990090 |
|---|
|
~99%
2-(5-methoxy-2,... CAS#:78698-48-3 |
| Literature: Nicolaou; Zipkin Angewandte Chemie, 1981 , vol. 93, # 9 p. 811 - 812 |
|
~%
2-(5-methoxy-2,... CAS#:78698-48-3 |
| Literature: Nicolaou; Zipkin Angewandte Chemie, 1981 , vol. 93, # 9 p. 811 - 812 |
|
~%
2-(5-methoxy-2,... CAS#:78698-48-3 |
| Literature: Nicolaou; Zipkin Angewandte Chemie, 1981 , vol. 93, # 9 p. 811 - 812 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1H-Indene-2-acetic acid,2,3-dihydro-5-methoxy |
| AGN-PC-0D3J3A |