2-(dibutylamino)-1-phenylethanone structure
|
Common Name | 2-(dibutylamino)-1-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 787-83-7 | Molecular Weight | 247.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(dibutylamino)-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H25NO |
|---|---|
| Molecular Weight | 247.37600 |
| Exact Mass | 247.19400 |
| PSA | 20.31000 |
| LogP | 3.77150 |
| InChIKey | UXLNDYCNDRHFPH-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CC(=O)c1ccccc1 |
|
~%
2-(dibutylamino... CAS#:787-83-7 |
| Literature: Golding; McNeely Journal of the American Chemical Society, 1946 , vol. 68, p. 1847 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| 2-(dibutylamino)-1-phenylethan-1-one |
| Ethanone,2-(dibutylamino)-1-phenyl |
| CTK2G4864 |
| Dibutyl-phenacylamin |
| 2-Dibutylamino-1-phenyl-aethanon |
| 2-dibutylamino-1-phenyl-ethanone |