Pyrido[3,2-d]pyrimidin-4(3H)-one, 2-amino-6-methyl- structure
|
Common Name | Pyrido[3,2-d]pyrimidin-4(3H)-one, 2-amino-6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 78711-30-5 | Molecular Weight | 176.17500 | |
| Density | 1.57g/cm3 | Boiling Point | 409.6ºC at 760mmHg | |
| Molecular Formula | C8H8N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.5ºC | |
| Name | 2-amino-6-methyl-1H-pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 409.6ºC at 760mmHg |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.17500 |
| Flash Point | 201.5ºC |
| Exact Mass | 176.07000 |
| PSA | 84.66000 |
| LogP | 0.78990 |
| Index of Refraction | 1.762 |
| InChIKey | KHQOTIXMGUTOSA-UHFFFAOYSA-N |
| SMILES | Cc1ccc2nc(N)[nH]c(=O)c2n1 |
|
~77%
Pyrido[3,2-d]py... CAS#:78711-30-5 |
| Literature: Temple Jr.; Kussner; Rose; Smithers; Bennett Jr.; Montgomery Journal of Medicinal Chemistry, 1981 , vol. 24, # 10 p. 1254 - 1258 |
|
~81%
Pyrido[3,2-d]py... CAS#:78711-30-5 |
| Literature: Srinivasan, Ananthachari; Broom, Arthur D. Journal of Organic Chemistry, 1982 , vol. 47, # 23 p. 4391 - 4396 |
| 2-amino-6-methyl-4-oxopyrido<3,2-d>pyrimidine |
| 6-methyl-8-deazapterin |