4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine structure
|
Common Name | 4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 78717-59-6 | Molecular Weight | 304.21900 | |
| Density | 1.227g/cm3 | Boiling Point | 439.2ºC at 760 mmHg | |
| Molecular Formula | C12H19Cl2N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.4ºC | |
| Name | 4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 439.2ºC at 760 mmHg |
| Molecular Formula | C12H19Cl2N5 |
| Molecular Weight | 304.21900 |
| Flash Point | 219.4ºC |
| Exact Mass | 303.10200 |
| PSA | 65.96000 |
| LogP | 2.65020 |
| Index of Refraction | 1.544 |
| InChIKey | KUCNLYDMWLYXSD-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(Nc2nc(Cl)nc(Cl)n2)CC(C)(C)N1 |
|
~%
4,6-dichloro-N-... CAS#:78717-59-6 |
| Literature: Ciba Specialty Chemicals Corporation Patent: US5847132 A1, 1998 ; |
|
~%
4,6-dichloro-N-... CAS#:78717-59-6 |
| Literature: Saleh, Mona; Abbott, Shaun; Perron, Valerie; Lauzon, Caroline; Penney, Christopher; Zacharie, Boulos Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 3 p. 945 - 949 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (4,6-dichloro-[1,3,5]triazin-2-yl)-(2,2,6,6-tetramethyl-piperidin-4-yl)-amine |
| (4,6-dichloro-[1,3,5]-triazin-2-yl)-(2,2,6,6-tetramethyl-4-piperidyl)-amine |
| AC1Q2CKX |
| AC1L4TVW |
| 2,2,6,6-Tetramethylpiperidine 4-amino-(N,N-dichlorotriazine) |
| 1,3,5-Triazin-2-amine,4,6-dichloro-N-(2,2,6,6-tetramethyl-4-piperidinyl) |