3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline
![3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline Structure](https://image.chemsrc.com/caspic/391/78747-70-3.png)
3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline structure
|
Common Name | 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline | ||
|---|---|---|---|---|
| CAS Number | 78747-70-3 | Molecular Weight | 287.66500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9ClF3NO |
|---|---|
| Molecular Weight | 287.66500 |
| Exact Mass | 287.03200 |
| PSA | 35.25000 |
| LogP | 5.31450 |
| InChIKey | HDEBLXPRSPLSDN-UHFFFAOYSA-N |
| SMILES | Nc1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~52%
3-[2-chloro-4-(... CAS#:78747-70-3 |
| Literature: Karp, Gary M. Journal of Organic Chemistry, 1992 , vol. 57, # 17 p. 4765 - 4772 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| CTK2G4985 |
| Benzenamine,3-[2-chloro-4-(trifluoromethyl)phenoxy] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline? |
| A: Related upstream materials(CAS) of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline: 78068-85-6;591-27-5. |
| Q: What English synonyms does 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline have? |
| A: English synonyms of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline: CTK2G4985, Benzenamine,3-[2-chloro-4-(trifluoromethyl)phenoxy]. |
| Q: What is the InChIKey of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline? |
| A: InChIKey of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline is HDEBLXPRSPLSDN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 78747-70-3? |
| A: Chinese name of 78747-70-3 is 78747-70-3. |
| Q: What is the polar surface area (PSA) of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline? |
| A: Polar surface area (PSA) of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline is 35.25000. |
| Q: What is the molecular formula of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline? |
| A: Molecular formula of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline is C13H9ClF3NO. |
| Q: What is the LogP of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline? |
| A: LogP of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline is 5.31450. |
| Q: What is the CAS number of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline? |
| A: CAS number of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline is 78747-70-3. |
| Q: What is the SMILES notation of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline? |
| A: SMILES notation of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline is Nc1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1. |
| Q: What is the English name of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline? |
| A: The English name of 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline is 3-[2-chloro-4-(trifluoromethyl)phenoxy]aniline. |