1-[[2-(1H-benzoimidazol-2-yl)acetyl]amino]-3-cyclohexyl-thiourea structure
|
Common Name | 1-[[2-(1H-benzoimidazol-2-yl)acetyl]amino]-3-cyclohexyl-thiourea | ||
|---|---|---|---|---|
| CAS Number | 78772-40-4 | Molecular Weight | 331.43600 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H21N5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[[2-(1H-benzimidazol-2-yl)acetyl]amino]-3-cyclohexylthiourea |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.43600 |
| Exact Mass | 331.14700 |
| PSA | 113.93000 |
| LogP | 3.10610 |
| Index of Refraction | 1.671 |
| InChIKey | DGFMTKJIBDBWTK-UHFFFAOYSA-N |
| SMILES | O=C(Cc1nc2ccccc2[nH]1)NNC(=S)NC1CCCCC1 |
|
~92%
1-[[2-(1H-benzo... CAS#:78772-40-4 |
| Literature: Sathi; Ahmad; Nath; et al. Journal of the Indian Chemical Society, 1981 , vol. 58, # 5 p. 525 - 527 |
|
~%
1-[[2-(1H-benzo... CAS#:78772-40-4 |
| Literature: Rida; Labouta; Salama; Ghany; el-Ghazzaui; Kader Pharmazie, 1986 , vol. 41, # 7 p. 475 - 478 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |