1-(decylsulfanylmethyl)-3-methylimidazol-3-ium,chloride structure
|
Common Name | 1-(decylsulfanylmethyl)-3-methylimidazol-3-ium,chloride | ||
|---|---|---|---|---|
| CAS Number | 78865-83-5 | Molecular Weight | 304.92200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H29ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(decylsulfanylmethyl)-3-methylimidazol-3-ium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H29ClN2S |
|---|---|
| Molecular Weight | 304.92200 |
| Exact Mass | 304.17400 |
| PSA | 34.11000 |
| LogP | 1.14800 |
| InChIKey | VMMIAWVAQJZGDW-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCCSCn1cc[n+](C)c1.[Cl-] |
|
~87%
1-(decylsulfany... CAS#:78865-83-5 |
| Literature: Pernak; Zygadlo; Branicka Polish Journal of Chemistry, 2005 , vol. 79, # 5 p. 867 - 881 |
|
~%
1-(decylsulfany... CAS#:78865-83-5 |
| Literature: Pernak; Zygadlo; Branicka Polish Journal of Chemistry, 2005 , vol. 79, # 5 p. 867 - 881 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| IPO 4580 |
| N-Methyl-N'-decylthiomethylimidazolyl chloride |
| 1-Methyl-3-n-decylthiomethylimidazoliniumchlorid |