6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine.1bromine structure
|
Common Name | 6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine.1bromine | ||
|---|---|---|---|---|
| CAS Number | 78867-38-6 | Molecular Weight | 327.404 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 337.9±52.0 °C at 760 mmHg | |
| Molecular Formula | C7H6Br2ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.1±30.7 °C | |
| Name | 1,3-dibromo-6-chloro-2-methyl-5H-imidazo[1,2-b]pyridazine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.9±52.0 °C at 760 mmHg |
| Molecular Formula | C7H6Br2ClN3 |
| Molecular Weight | 327.404 |
| Flash Point | 158.1±30.7 °C |
| Exact Mass | 324.861694 |
| PSA | 25.13000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.774 |
| InChIKey | AKBXLEGARWENOM-UHFFFAOYSA-N |
| SMILES | CC1=C(Br)N2NC(Cl)=CC=C2N1Br |
| HS Code | 2933990090 |
|---|
|
~92%
6-chloro-2-Meth... CAS#:78867-38-6 |
| Literature: Stanovnik, Branko; Tisler, Miha; Jurgec, Milan; Rucman, Rudolf Heterocycles, 1981 , vol. 16, # 5 p. 741 - 745 |
|
~88%
6-chloro-2-Meth... CAS#:78867-38-6 |
| Literature: Stanovnik, Branko; Tisler, Miha; Jurgec, Milan; Rucman, Rudolf Heterocycles, 1981 , vol. 16, # 5 p. 741 - 745 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dibromo-6-chloro-2-methyl-1,5-dihydroimidazo[1,2-b]pyridazine |
| Imidazo[1,2-b]pyridazine, 1,3-dibromo-6-chloro-1,5-dihydro-2-methyl- |
| 3-bromo-6-chloro-2-methylimidazo/1,2-b/pyridazine-bromine complex |
| S14-2944 |