2-Propen-1-one,1-(4-bromophenyl)-2-(1-piperidinylmethyl)-, hydrochloride (1:1) structure
|
Common Name | 2-Propen-1-one,1-(4-bromophenyl)-2-(1-piperidinylmethyl)-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 78888-53-6 | Molecular Weight | 344.67400 | |
| Density | 1.291g/cm3 | Boiling Point | 402.6ºC at 760 mmHg | |
| Molecular Formula | C15H19BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.3ºC | |
| Name | 1-(4-bromophenyl)-2-(piperidin-1-ylmethyl)prop-2-en-1-one,hydrochloride |
|---|
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 402.6ºC at 760 mmHg |
| Molecular Formula | C15H19BrClNO |
| Molecular Weight | 344.67400 |
| Flash Point | 197.3ºC |
| Exact Mass | 343.03400 |
| PSA | 20.31000 |
| LogP | 4.41380 |
| Index of Refraction | 1.562 |
| InChIKey | WVUOHLBXFCSWAM-UHFFFAOYSA-N |
| SMILES | C=C(CN1CCCCC1)C(=O)c1ccc(Br)cc1.Cl |
|
~%
2-Propen-1-one,... CAS#:78888-53-6 |
| Literature: Gupta; Nautiyal; Jhingran; Kamboj; Setty; Anand Indian journal of chemistry, 1981 , vol. 20 B, # 4 p. 303 - 307 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |